About [(3Z)-1-hydrazinylhexa-3,5-dienyl]hydrazine
[(3Z)-1-hydrazinylhexa-3,5-dienyl]hydrazine (PubChem CID 138511707) has the molecular formula C6H14N4
and a molecular weight of 142.21 g/mol. Its IUPAC name is [(3Z)-1-hydrazinylhexa-3,5-dienyl]hydrazine.
Molecular Properties
| Compound Name | [(3Z)-1-hydrazinylhexa-3,5-dienyl]hydrazine |
| PubChem CID | 138511707 |
| Molecular Formula | C6H14N4 |
| Molecular Weight | 142.21 g/mol |
| Exact Mass | 142.12 |
| IUPAC Name | [(3Z)-1-hydrazinylhexa-3,5-dienyl]hydrazine |
| SMILES | C=C/C=C\CC(NN)NN |
| InChI | InChI=1S/C6H14N4/c1-2-3-4-5-6(9-7)10-8/h2-4,6,9-10H,1,5,7-8H2/b4-3- |
| InChIKey | ACTVCIMZLPYHMF-ARJAWSKDSA-N |
| XLogP | -0.63 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.21 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(3Z)-1-hydrazinylhexa-3,5-dienyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3Z)-1-hydrazinylhexa-3,5-dienyl]hydrazine?
The IUPAC name of [(3Z)-1-hydrazinylhexa-3,5-dienyl]hydrazine (CID 138511707) is [(3Z)-1-hydrazinylhexa-3,5-dienyl]hydrazine.
What is the SMILES notation for [(3Z)-1-hydrazinylhexa-3,5-dienyl]hydrazine?
The canonical SMILES for [(3Z)-1-hydrazinylhexa-3,5-dienyl]hydrazine is C=C/C=C\CC(NN)NN.
What is the InChIKey of [(3Z)-1-hydrazinylhexa-3,5-dienyl]hydrazine?
The InChIKey is ACTVCIMZLPYHMF-ARJAWSKDSA-N. The full InChI is InChI=1S/C6H14N4/c1-2-3-4-5-6(9-7)10-8/h2-4,6,9-10H,1,5,7-8H2/b4-3-.
What are the key properties of [(3Z)-1-hydrazinylhexa-3,5-dienyl]hydrazine?
[(3Z)-1-hydrazinylhexa-3,5-dienyl]hydrazine has a molecular weight of 142.21 g/mol, XLogP of -0.63, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3Z)-1-hydrazinylhexa-3,5-dienyl]hydrazine is sourced from PubChem (CID 138511707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).