C16H28N4 — CID 138511887
N'-[(1Z,3E)-3-ethenyl-4-(methylideneamino)penta-1,3-dienyl]-N'-methyl-N-(piperidin-4-ylmethyl)methanediamine (PubChem CID 138511887) has the molecular formula C16H28N4 and a molecular weight of 276.43 g/mol. Its IUPAC name is N'-[(1Z,3E)-3-ethenyl-4-(methylideneamino)penta-1,3-dienyl]-N'-methyl-N-(piperidin-4-ylmethyl)methanediamine.
| Compound Name | N'-[(1Z,3E)-3-ethenyl-4-(methylideneamino)penta-1,3-dienyl]-N'-methyl-N-(piperidin-4-ylmethyl)methanediamine |
|---|---|
| PubChem CID | 138511887 |
| Molecular Formula | C16H28N4 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | N'-[(1Z,3E)-3-ethenyl-4-(methylideneamino)penta-1,3-dienyl]-N'-methyl-N-(piperidin-4-ylmethyl)methanediamine |
| SMILES | C=CC(/C=C\N(C)CNCC1CCNCC1)=C(/C)N=C |
| InChI | InChI=1S/C16H28N4/c1-5-16(14(2)17-3)8-11-20(4)13-19-12-15-6-9-18-10-7-15/h5,8,11,15,18-19H,1,3,6-7,9-10,12-13H2,2,4H3/b11-8-,16-14+ |
| InChIKey | HTSJAGHULHMEGF-SLEQVBRZSA-N |
| XLogP | 2.14 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|