C23H36N2 — CID 138511975
6-(4-butan-2-yl-1-methylcyclohepta-2,4-dien-1-yl)-3-imino-4-pentylcyclohexa-1,4-dien-1-amine (PubChem CID 138511975) has the molecular formula C23H36N2 and a molecular weight of 340.56 g/mol. Its IUPAC name is 6-(4-butan-2-yl-1-methylcyclohepta-2,4-dien-1-yl)-3-imino-4-pentylcyclohexa-1,4-dien-1-amine.
| Compound Name | 6-(4-butan-2-yl-1-methylcyclohepta-2,4-dien-1-yl)-3-imino-4-pentylcyclohexa-1,4-dien-1-amine |
|---|---|
| PubChem CID | 138511975 |
| Molecular Formula | C23H36N2 |
| Molecular Weight | 340.56 g/mol |
| Exact Mass | 340.29 |
| IUPAC Name | 6-(4-butan-2-yl-1-methylcyclohepta-2,4-dien-1-yl)-3-imino-4-pentylcyclohexa-1,4-dien-1-amine |
| SMILES | [H]/N=C1\C=C(N)C(C2(C)C=CC(C(C)CC)=CCC2)C=C1CCCCC |
| InChI | InChI=1S/C23H36N2/c1-5-7-8-10-19-15-20(22(25)16-21(19)24)23(4)13-9-11-18(12-14-23)17(3)6-2/h11-12,14-17,20,24H,5-10,13,25H2,1-4H3/b24-21+ |
| InChIKey | OSKZTMUEHTUEFK-DARPEHSRSA-N |
| XLogP | 6.31 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.56 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|