C19H27N — CID 138512161
(3E)-2-(4-butyl-3,6-dimethylidenecyclohexa-1,4-dien-1-yl)-N-methylhexa-3,5-dien-3-amine (PubChem CID 138512161) has the molecular formula C19H27N and a molecular weight of 269.43 g/mol. Its IUPAC name is (3E)-2-(4-butyl-3,6-dimethylidenecyclohexa-1,4-dien-1-yl)-N-methylhexa-3,5-dien-3-amine.
| Compound Name | (3E)-2-(4-butyl-3,6-dimethylidenecyclohexa-1,4-dien-1-yl)-N-methylhexa-3,5-dien-3-amine |
|---|---|
| PubChem CID | 138512161 |
| Molecular Formula | C19H27N |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | (3E)-2-(4-butyl-3,6-dimethylidenecyclohexa-1,4-dien-1-yl)-N-methylhexa-3,5-dien-3-amine |
| SMILES | C=C/C=C(/NC)C(C)c1cc(=C)c(CCCC)cc1=C |
| InChI | InChI=1S/C19H27N/c1-7-9-11-17-12-15(4)18(13-14(17)3)16(5)19(20-6)10-8-2/h8,10,12-13,16,20H,2-4,7,9,11H2,1,5-6H3/b19-10+ |
| InChIKey | ABTFMZOAZUQNHC-VXLYETTFSA-N |
| XLogP | 3.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|