C9H16F3NO — CID 138512249
2,2,2-trifluoro-1-[methyl-[(1S,2S)-2-propylcyclopropyl]amino]ethanol (PubChem CID 138512249) has the molecular formula C9H16F3NO and a molecular weight of 211.23 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[methyl-[(1S,2S)-2-propylcyclopropyl]amino]ethanol.
| Compound Name | 2,2,2-trifluoro-1-[methyl-[(1S,2S)-2-propylcyclopropyl]amino]ethanol |
|---|---|
| PubChem CID | 138512249 |
| Molecular Formula | C9H16F3NO |
| Molecular Weight | 211.23 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 2,2,2-trifluoro-1-[methyl-[(1S,2S)-2-propylcyclopropyl]amino]ethanol |
| SMILES | CCC[C@H]1C[C@@H]1N(C)C(O)C(F)(F)F |
| InChI | InChI=1S/C9H16F3NO/c1-3-4-6-5-7(6)13(2)8(14)9(10,11)12/h6-8,14H,3-5H2,1-2H3/t6-,7-,8?/m0/s1 |
| InChIKey | UGBUNPBDMIXNDV-WPZUCAASSA-N |
| XLogP | 1.99 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.23 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|