C35H24N2 — CID 138512341
23-(6-phenyl-2-pyridinyl)-23-azahexacyclo[16.6.1.02,11.04,9.012,17.022,25]pentacosa-1(24),2,5,7,10,12,14,16,18(25),19,21-undecaene (PubChem CID 138512341) has the molecular formula C35H24N2 and a molecular weight of 472.59 g/mol. Its IUPAC name is 23-(6-phenyl-2-pyridinyl)-23-azahexacyclo[16.6.1.02,11.04,9.012,17.022,25]pentacosa-1(24),2,5,7,10,12,14,16,18(25),19,21-undecaene.
| Compound Name | 23-(6-phenyl-2-pyridinyl)-23-azahexacyclo[16.6.1.02,11.04,9.012,17.022,25]pentacosa-1(24),2,5,7,10,12,14,16,18(25),19,21-undecaene |
|---|---|
| PubChem CID | 138512341 |
| Molecular Formula | C35H24N2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 23-(6-phenyl-2-pyridinyl)-23-azahexacyclo[16.6.1.02,11.04,9.012,17.022,25]pentacosa-1(24),2,5,7,10,12,14,16,18(25),19,21-undecaene |
| SMILES | C1=CC2C=C3C(=CC2C=C1)c1cn(-c2cccc(-c4ccccc4)n2)c2cccc(c12)-c1ccccc13 |
| InChI | InChI=1S/C35H24N2/c1-2-10-23(11-3-1)32-17-9-19-34(36-32)37-22-31-30-21-25-13-5-4-12-24(25)20-29(30)27-15-7-6-14-26(27)28-16-8-18-33(37)35(28)31/h1-22,24-25H |
| InChIKey | GEURSYRMNQDENN-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |