C11H17N — CID 138512369
N-[(1Z,3E)-3-methylhexa-1,3,5-trienyl]butan-2-imine (PubChem CID 138512369) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is N-[(1Z,3E)-3-methylhexa-1,3,5-trienyl]butan-2-imine.
| Compound Name | N-[(1Z,3E)-3-methylhexa-1,3,5-trienyl]butan-2-imine |
|---|---|
| PubChem CID | 138512369 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | N-[(1Z,3E)-3-methylhexa-1,3,5-trienyl]butan-2-imine |
| SMILES | C=C/C=C(C)/C=C\N=C(/C)CC |
| InChI | InChI=1S/C11H17N/c1-5-7-10(3)8-9-12-11(4)6-2/h5,7-9H,1,6H2,2-4H3/b9-8-,10-7+,12-11+ |
| InChIKey | ZHFNDHFOBKAQLP-DOELPLFGSA-N |
| XLogP | 3.50 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|