C22H35N — CID 138513978
2-[(3E,10Z)-6,9-dimethyl-7-methylidenetrideca-3,10-dien-4-yl]-4-methyl-1,2-dihydropyridine (PubChem CID 138513978) has the molecular formula C22H35N and a molecular weight of 313.53 g/mol. Its IUPAC name is 2-[(3E,10Z)-6,9-dimethyl-7-methylidenetrideca-3,10-dien-4-yl]-4-methyl-1,2-dihydropyridine.
| Compound Name | 2-[(3E,10Z)-6,9-dimethyl-7-methylidenetrideca-3,10-dien-4-yl]-4-methyl-1,2-dihydropyridine |
|---|---|
| PubChem CID | 138513978 |
| Molecular Formula | C22H35N |
| Molecular Weight | 313.53 g/mol |
| Exact Mass | 313.28 |
| IUPAC Name | 2-[(3E,10Z)-6,9-dimethyl-7-methylidenetrideca-3,10-dien-4-yl]-4-methyl-1,2-dihydropyridine |
| SMILES | C=C(CC(C)/C=C\CC)C(C)C/C(=C\CC)C1C=C(C)C=CN1 |
| InChI | InChI=1S/C22H35N/c1-7-9-11-17(3)14-19(5)20(6)16-21(10-8-2)22-15-18(4)12-13-23-22/h9-13,15,17,20,22-23H,5,7-8,14,16H2,1-4,6H3/b11-9-,21-10+ |
| InChIKey | RWZVKVWIZXAOTQ-LONVQWMRSA-N |
| XLogP | 6.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.53 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|