About 5-fluoro-2,4-dimethylcyclohexan-1-ol
5-fluoro-2,4-dimethylcyclohexan-1-ol (PubChem CID 138514168) has the molecular formula C8H15FO
and a molecular weight of 146.21 g/mol. Its IUPAC name is 5-fluoro-2,4-dimethylcyclohexan-1-ol.
Molecular Properties
| Compound Name | 5-fluoro-2,4-dimethylcyclohexan-1-ol |
| PubChem CID | 138514168 |
| Molecular Formula | C8H15FO |
| Molecular Weight | 146.21 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | 5-fluoro-2,4-dimethylcyclohexan-1-ol |
| SMILES | CC1CC(C)C(F)CC1O |
| InChI | InChI=1S/C8H15FO/c1-5-3-6(2)8(10)4-7(5)9/h5-8,10H,3-4H2,1-2H3 |
| InChIKey | LWIWZRPYUJXLFQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.21 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-fluoro-2,4-dimethylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2,4-dimethylcyclohexan-1-ol?
The IUPAC name of 5-fluoro-2,4-dimethylcyclohexan-1-ol (CID 138514168) is 5-fluoro-2,4-dimethylcyclohexan-1-ol.
What is the SMILES notation for 5-fluoro-2,4-dimethylcyclohexan-1-ol?
The canonical SMILES for 5-fluoro-2,4-dimethylcyclohexan-1-ol is CC1CC(C)C(F)CC1O.
What is the InChIKey of 5-fluoro-2,4-dimethylcyclohexan-1-ol?
The InChIKey is LWIWZRPYUJXLFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15FO/c1-5-3-6(2)8(10)4-7(5)9/h5-8,10H,3-4H2,1-2H3.
What are the key properties of 5-fluoro-2,4-dimethylcyclohexan-1-ol?
5-fluoro-2,4-dimethylcyclohexan-1-ol has a molecular weight of 146.21 g/mol, XLogP of 1.75, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2,4-dimethylcyclohexan-1-ol is sourced from PubChem (CID 138514168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).