C13H12O3 — CID 138514647
(1S,3E,5R)-3-benzylidene-6,8-dioxabicyclo[3.2.1]octan-4-one (PubChem CID 138514647) has the molecular formula C13H12O3 and a molecular weight of 216.24 g/mol. Its IUPAC name is (1S,3E,5R)-3-benzylidene-6,8-dioxabicyclo[3.2.1]octan-4-one.
| Compound Name | (1S,3E,5R)-3-benzylidene-6,8-dioxabicyclo[3.2.1]octan-4-one |
|---|---|
| PubChem CID | 138514647 |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | (1S,3E,5R)-3-benzylidene-6,8-dioxabicyclo[3.2.1]octan-4-one |
| SMILES | O=C1/C(=C/c2ccccc2)C[C@H]2CO[C@@H]1O2 |
| InChI | InChI=1S/C13H12O3/c14-12-10(6-9-4-2-1-3-5-9)7-11-8-15-13(12)16-11/h1-6,11,13H,7-8H2/b10-6+/t11-,13+/m0/s1 |
| InChIKey | CWWUZEACMKDZAP-AMLRMPNFSA-N |
| XLogP | 1.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|