C20H20O3 — CID 138514684
(1S,5R)-3,3-dibenzyl-6,8-dioxabicyclo[3.2.1]octan-4-one (PubChem CID 138514684) has the molecular formula C20H20O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is (1S,5R)-3,3-dibenzyl-6,8-dioxabicyclo[3.2.1]octan-4-one.
| Compound Name | (1S,5R)-3,3-dibenzyl-6,8-dioxabicyclo[3.2.1]octan-4-one |
|---|---|
| PubChem CID | 138514684 |
| Molecular Formula | C20H20O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | (1S,5R)-3,3-dibenzyl-6,8-dioxabicyclo[3.2.1]octan-4-one |
| SMILES | O=C1[C@@H]2OC[C@H](CC1(Cc1ccccc1)Cc1ccccc1)O2 |
| InChI | InChI=1S/C20H20O3/c21-18-19-22-14-17(23-19)13-20(18,11-15-7-3-1-4-8-15)12-16-9-5-2-6-10-16/h1-10,17,19H,11-14H2/t17-,19+/m0/s1 |
| InChIKey | YLNONBIAEVXFFF-PKOBYXMFSA-N |
| XLogP | 3.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |