C28H30O4 — CID 138514744
[(1S,4S,5R)-3,3-dibenzyl-6,8-dioxabicyclo[3.2.1]octan-4-yl] bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 138514744) has the molecular formula C28H30O4 and a molecular weight of 430.54 g/mol. Its IUPAC name is [(1S,4S,5R)-3,3-dibenzyl-6,8-dioxabicyclo[3.2.1]octan-4-yl] bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | [(1S,4S,5R)-3,3-dibenzyl-6,8-dioxabicyclo[3.2.1]octan-4-yl] bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 138514744 |
| Molecular Formula | C28H30O4 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | [(1S,4S,5R)-3,3-dibenzyl-6,8-dioxabicyclo[3.2.1]octan-4-yl] bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C(O[C@@H]1[C@@H]2OC[C@H](CC1(Cc1ccccc1)Cc1ccccc1)O2)C1CC2C=CC1C2 |
| InChI | InChI=1S/C28H30O4/c29-26(24-14-21-11-12-22(24)13-21)32-25-27-30-18-23(31-27)17-28(25,15-19-7-3-1-4-8-19)16-20-9-5-2-6-10-20/h1-12,21-25,27H,13-18H2/t21?,22?,23-,24?,25+,27+/m0/s1 |
| InChIKey | PPYJHPKJCGLJQG-OBIKWZPDSA-N |
| XLogP | 4.73 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|