About 1-(1-adamantyl)-3-(2,3-dithiophen-2-ylquinoxalin-6-yl)urea
1-(1-adamantyl)-3-(2,3-dithiophen-2-ylquinoxalin-6-yl)urea (PubChem CID 138514843) has the molecular formula C27H26N4OS2
and a molecular weight of 486.67 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-(2,3-dithiophen-2-ylquinoxalin-6-yl)urea.
Molecular Properties
| Compound Name | 1-(1-adamantyl)-3-(2,3-dithiophen-2-ylquinoxalin-6-yl)urea |
| PubChem CID | 138514843 |
| Molecular Formula | C27H26N4OS2 |
| Molecular Weight | 486.67 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 1-(1-adamantyl)-3-(2,3-dithiophen-2-ylquinoxalin-6-yl)urea |
| SMILES | O=C(Nc1ccc2nc(-c3cccs3)c(-c3cccs3)nc2c1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C27H26N4OS2/c32-26(31-27-13-16-9-17(14-27)11-18(10-16)15-27)28-19-5-6-20-21(12-19)30-25(23-4-2-8-34-23)24(29-20)22-3-1-7-33-22/h1-8,12,16-18H,9-11,13-15H2,(H2,28,31,32) |
| InChIKey | SCPZMCCNFFWXMO-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.67 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(1-adamantyl)-3-(2,3-dithiophen-2-ylquinoxalin-6-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-adamantyl)-3-(2,3-dithiophen-2-ylquinoxalin-6-yl)urea?
The IUPAC name of 1-(1-adamantyl)-3-(2,3-dithiophen-2-ylquinoxalin-6-yl)urea (CID 138514843) is 1-(1-adamantyl)-3-(2,3-dithiophen-2-ylquinoxalin-6-yl)urea.
What is the SMILES notation for 1-(1-adamantyl)-3-(2,3-dithiophen-2-ylquinoxalin-6-yl)urea?
The canonical SMILES for 1-(1-adamantyl)-3-(2,3-dithiophen-2-ylquinoxalin-6-yl)urea is O=C(Nc1ccc2nc(-c3cccs3)c(-c3cccs3)nc2c1)NC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-(1-adamantyl)-3-(2,3-dithiophen-2-ylquinoxalin-6-yl)urea?
The InChIKey is SCPZMCCNFFWXMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H26N4OS2/c32-26(31-27-13-16-9-17(14-27)11-18(10-16)15-27)28-19-5-6-20-21(12-19)30-25(23-4-2-8-34-23)24(29-20)22-3-1-7-33-22/h1-8,12,16-18H,9-11,13-15H2,(H2,28,31,32).
What are the key properties of 1-(1-adamantyl)-3-(2,3-dithiophen-2-ylquinoxalin-6-yl)urea?
1-(1-adamantyl)-3-(2,3-dithiophen-2-ylquinoxalin-6-yl)urea has a molecular weight of 486.67 g/mol, XLogP of 7.18, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-adamantyl)-3-(2,3-dithiophen-2-ylquinoxalin-6-yl)urea is sourced from PubChem (CID 138514843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).