C26H23N7O3S — CID 138515134
[(E)-N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 5-cyano-3-morpholin-4-ylthiophene-2-carboximidate (PubChem CID 138515134) has the molecular formula C26H23N7O3S and a molecular weight of 513.58 g/mol. Its IUPAC name is [(E)-N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 5-cyano-3-morpholin-4-ylthiophene-2-carboximidate.
| Compound Name | [(E)-N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 5-cyano-3-morpholin-4-ylthiophene-2-carboximidate |
|---|---|
| PubChem CID | 138515134 |
| Molecular Formula | C26H23N7O3S |
| Molecular Weight | 513.58 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | [(E)-N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 5-cyano-3-morpholin-4-ylthiophene-2-carboximidate |
| SMILES | [H]/N=C(/O/C(N)=N/C1N=C(c2ccccc2)c2ccccc2NC1=O)c1sc(C#N)cc1N1CCOCC1 |
| InChI | InChI=1S/C26H23N7O3S/c27-15-17-14-20(33-10-12-35-13-11-33)22(37-17)23(28)36-26(29)32-24-25(34)30-19-9-5-4-8-18(19)21(31-24)16-6-2-1-3-7-16/h1-9,14,24,28H,10-13H2,(H2,29,32)(H,30,34)/b28-23+ |
| InChIKey | FPIIIBQYRUUFSG-WEMUOSSPSA-N |
| XLogP | 2.93 |
| TPSA | 149.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.58 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|