C15H26FN — CID 138515161
(3Z,5Z)-6-fluoro-2,4,8-trimethyl-3-propan-2-ylnona-1,3,5-trien-5-amine (PubChem CID 138515161) has the molecular formula C15H26FN and a molecular weight of 239.38 g/mol. Its IUPAC name is (3Z,5Z)-6-fluoro-2,4,8-trimethyl-3-propan-2-ylnona-1,3,5-trien-5-amine.
| Compound Name | (3Z,5Z)-6-fluoro-2,4,8-trimethyl-3-propan-2-ylnona-1,3,5-trien-5-amine |
|---|---|
| PubChem CID | 138515161 |
| Molecular Formula | C15H26FN |
| Molecular Weight | 239.38 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | (3Z,5Z)-6-fluoro-2,4,8-trimethyl-3-propan-2-ylnona-1,3,5-trien-5-amine |
| SMILES | C=C(C)/C(=C(C)\C(N)=C(\F)CC(C)C)C(C)C |
| InChI | InChI=1S/C15H26FN/c1-9(2)8-13(16)15(17)12(7)14(10(3)4)11(5)6/h9,11H,3,8,17H2,1-2,4-7H3/b14-12+,15-13- |
| InChIKey | IWCYBUIRWSTZNH-GQJHWZHGSA-N |
| XLogP | 4.72 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.38 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|