C27H25FN6O3 — CID 138515285
[(E)-N'-[(3R)-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl]carbamimidoyl] 2-fluoro-4-morpholin-4-ylbenzenecarboximidate (PubChem CID 138515285) has the molecular formula C27H25FN6O3 and a molecular weight of 500.53 g/mol. Its IUPAC name is [(E)-N'-[(3R)-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl]carbamimidoyl] 2-fluoro-4-morpholin-4-ylbenzenecarboximidate.
| Compound Name | [(E)-N'-[(3R)-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl]carbamimidoyl] 2-fluoro-4-morpholin-4-ylbenzenecarboximidate |
|---|---|
| PubChem CID | 138515285 |
| Molecular Formula | C27H25FN6O3 |
| Molecular Weight | 500.53 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | [(E)-N'-[(3R)-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl]carbamimidoyl] 2-fluoro-4-morpholin-4-ylbenzenecarboximidate |
| SMILES | [H]/N=C(/O/C(N)=N/[C@H]1N=C(c2ccccc2)c2ccccc2NC1=O)c1ccc(N2CCOCC2)cc1F |
| InChI | InChI=1S/C27H25FN6O3/c28-21-16-18(34-12-14-36-15-13-34)10-11-19(21)24(29)37-27(30)33-25-26(35)31-22-9-5-4-8-20(22)23(32-25)17-6-2-1-3-7-17/h1-11,16,25,29H,12-15H2,(H2,30,33)(H,31,35)/b29-24+/t25-/m1/s1 |
| InChIKey | WBXDBRCLEZGUBG-JJMKSGPCSA-N |
| XLogP | 3.13 |
| TPSA | 125.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.53 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|