C26H26N6O3S — CID 138515306
[(E)-N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 5-methyl-2-morpholin-4-ylthiophene-3-carboximidate (PubChem CID 138515306) has the molecular formula C26H26N6O3S and a molecular weight of 502.60 g/mol. Its IUPAC name is [(E)-N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 5-methyl-2-morpholin-4-ylthiophene-3-carboximidate.
| Compound Name | [(E)-N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 5-methyl-2-morpholin-4-ylthiophene-3-carboximidate |
|---|---|
| PubChem CID | 138515306 |
| Molecular Formula | C26H26N6O3S |
| Molecular Weight | 502.60 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | [(E)-N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 5-methyl-2-morpholin-4-ylthiophene-3-carboximidate |
| SMILES | [H]/N=C(/O/C(N)=N/C1N=C(c2ccccc2)c2ccccc2NC1=O)c1cc(C)sc1N1CCOCC1 |
| InChI | InChI=1S/C26H26N6O3S/c1-16-15-19(25(36-16)32-11-13-34-14-12-32)22(27)35-26(28)31-23-24(33)29-20-10-6-5-9-18(20)21(30-23)17-7-3-2-4-8-17/h2-10,15,23,27H,11-14H2,1H3,(H2,28,31)(H,29,33)/b27-22+ |
| InChIKey | CNSSLTMOPNUCIP-HPNDGRJYSA-N |
| XLogP | 3.37 |
| TPSA | 125.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.60 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|