C28H28N6O3S — CID 138515502
[(E)-N'-[(3R)-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl]carbamimidoyl] 5-cyclopropyl-2-morpholin-4-ylthiophene-3-carboximidate (PubChem CID 138515502) has the molecular formula C28H28N6O3S and a molecular weight of 528.64 g/mol. Its IUPAC name is [(E)-N'-[(3R)-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl]carbamimidoyl] 5-cyclopropyl-2-morpholin-4-ylthiophene-3-carboximidate.
| Compound Name | [(E)-N'-[(3R)-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl]carbamimidoyl] 5-cyclopropyl-2-morpholin-4-ylthiophene-3-carboximidate |
|---|---|
| PubChem CID | 138515502 |
| Molecular Formula | C28H28N6O3S |
| Molecular Weight | 528.64 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | [(E)-N'-[(3R)-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl]carbamimidoyl] 5-cyclopropyl-2-morpholin-4-ylthiophene-3-carboximidate |
| SMILES | [H]/N=C(/O/C(N)=N/[C@H]1N=C(c2ccccc2)c2ccccc2NC1=O)c1cc(C2CC2)sc1N1CCOCC1 |
| InChI | InChI=1S/C28H28N6O3S/c29-24(20-16-22(17-10-11-17)38-27(20)34-12-14-36-15-13-34)37-28(30)33-25-26(35)31-21-9-5-4-8-19(21)23(32-25)18-6-2-1-3-7-18/h1-9,16-17,25,29H,10-15H2,(H2,30,33)(H,31,35)/b29-24+/t25-/m1/s1 |
| InChIKey | WOEFFYTXCGHILX-JJMKSGPCSA-N |
| XLogP | 3.93 |
| TPSA | 125.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.64 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|