C10H6Cl6O3 — CID 138515793
3-acetyl-1,4,5,6,7,7-hexachlorobicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 138515793) has the molecular formula C10H6Cl6O3 and a molecular weight of 386.87 g/mol. Its IUPAC name is 3-acetyl-1,4,5,6,7,7-hexachlorobicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | 3-acetyl-1,4,5,6,7,7-hexachlorobicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 138515793 |
| Molecular Formula | C10H6Cl6O3 |
| Molecular Weight | 386.87 g/mol |
| Exact Mass | 383.84 |
| IUPAC Name | 3-acetyl-1,4,5,6,7,7-hexachlorobicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | CC(=O)C1C(C(=O)O)C2(Cl)C(Cl)=C(Cl)C1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C10H6Cl6O3/c1-2(17)3-4(7(18)19)9(14)6(12)5(11)8(3,13)10(9,15)16/h3-4H,1H3,(H,18,19) |
| InChIKey | JGVLKRQPGOXJII-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.87 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|