C18H22FN3O — CID 138515812
(1-ethylcyclopropyl)-[(5S,7S)-7-fluoro-5-(1-methylcyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone (PubChem CID 138515812) has the molecular formula C18H22FN3O and a molecular weight of 315.39 g/mol. Its IUPAC name is (1-ethylcyclopropyl)-[(5S,7S)-7-fluoro-5-(1-methylcyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone.
| Compound Name | (1-ethylcyclopropyl)-[(5S,7S)-7-fluoro-5-(1-methylcyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone |
|---|---|
| PubChem CID | 138515812 |
| Molecular Formula | C18H22FN3O |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | (1-ethylcyclopropyl)-[(5S,7S)-7-fluoro-5-(1-methylcyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone |
| SMILES | CCC1(C(=O)c2nc3n(n2)[C@H](C2(C)C=CC=CC2)C[C@@H]3F)CC1 |
| InChI | InChI=1S/C18H22FN3O/c1-3-18(9-10-18)14(23)15-20-16-12(19)11-13(22(16)21-15)17(2)7-5-4-6-8-17/h4-7,12-13H,3,8-11H2,1-2H3/t12-,13-,17?/m0/s1 |
| InChIKey | IVPHFQMBSMOUHA-RNWUTADCSA-N |
| XLogP | 4.13 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |