C16H18FN3O — CID 138515831
cyclopropyl-[(5S)-5-[(3E,5Z)-3-fluorohepta-1,3,5-trien-2-yl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone (PubChem CID 138515831) has the molecular formula C16H18FN3O and a molecular weight of 287.34 g/mol. Its IUPAC name is cyclopropyl-[(5S)-5-[(3E,5Z)-3-fluorohepta-1,3,5-trien-2-yl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone.
| Compound Name | cyclopropyl-[(5S)-5-[(3E,5Z)-3-fluorohepta-1,3,5-trien-2-yl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone |
|---|---|
| PubChem CID | 138515831 |
| Molecular Formula | C16H18FN3O |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | cyclopropyl-[(5S)-5-[(3E,5Z)-3-fluorohepta-1,3,5-trien-2-yl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone |
| SMILES | C=C(/C(F)=C\C=C/C)[C@@H]1CCc2nc(C(=O)C3CC3)nn21 |
| InChI | InChI=1S/C16H18FN3O/c1-3-4-5-12(17)10(2)13-8-9-14-18-16(19-20(13)14)15(21)11-6-7-11/h3-5,11,13H,2,6-9H2,1H3/b4-3-,12-5+/t13-/m0/s1 |
| InChIKey | VITLTELLEZKPCX-OYYOTOCRSA-N |
| XLogP | 3.34 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|