C18H24BrN3O4S — CID 138516003
1-[5-bromo-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]-1,2,4-triazol-3-yl]-3-(3-methoxyphenyl)propane-1,3-dione (PubChem CID 138516003) has the molecular formula C18H24BrN3O4S and a molecular weight of 458.38 g/mol. Its IUPAC name is 1-[5-bromo-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]-1,2,4-triazol-3-yl]-3-(3-methoxyphenyl)propane-1,3-dione.
| Compound Name | 1-[5-bromo-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]-1,2,4-triazol-3-yl]-3-(3-methoxyphenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 138516003 |
| Molecular Formula | C18H24BrN3O4S |
| Molecular Weight | 458.38 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | 1-[5-bromo-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]-1,2,4-triazol-3-yl]-3-(3-methoxyphenyl)propane-1,3-dione |
| SMILES | COc1cccc(C(=O)CC(=O)c2nc(Br)n(COCCS(C)(C)C)n2)c1 |
| InChI | InChI=1S/C18H24BrN3O4S/c1-25-14-7-5-6-13(10-14)15(23)11-16(24)17-20-18(19)22(21-17)12-26-8-9-27(2,3)4/h5-7,10H,8-9,11-12H2,1-4H3 |
| InChIKey | RUPMYVVAKOMARL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|