C16H19N5O2 — CID 138516142
4-N-[(4aR)-2,4,4a,5-tetrahydro-1H-[1,4]oxazino[3,4-c][1,4]benzoxazin-8-yl]-6-N-methylpyrimidine-4,6-diamine (PubChem CID 138516142) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is 4-N-[(4aR)-2,4,4a,5-tetrahydro-1H-[1,4]oxazino[3,4-c][1,4]benzoxazin-8-yl]-6-N-methylpyrimidine-4,6-diamine.
| Compound Name | 4-N-[(4aR)-2,4,4a,5-tetrahydro-1H-[1,4]oxazino[3,4-c][1,4]benzoxazin-8-yl]-6-N-methylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 138516142 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 4-N-[(4aR)-2,4,4a,5-tetrahydro-1H-[1,4]oxazino[3,4-c][1,4]benzoxazin-8-yl]-6-N-methylpyrimidine-4,6-diamine |
| SMILES | CNc1cc(Nc2ccc3c(c2)OC[C@H]2COCCN32)ncn1 |
| InChI | InChI=1S/C16H19N5O2/c1-17-15-7-16(19-10-18-15)20-11-2-3-13-14(6-11)23-9-12-8-22-5-4-21(12)13/h2-3,6-7,10,12H,4-5,8-9H2,1H3,(H2,17,18,19,20)/t12-/m1/s1 |
| InChIKey | LHLNYGUCIWAASU-GFCCVEGCSA-N |
| XLogP | 1.86 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |