C18H18F3N3O5 — CID 138516698
[(2R,3S,4R)-3-acetyloxy-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl acetate (PubChem CID 138516698) has the molecular formula C18H18F3N3O5 and a molecular weight of 413.35 g/mol. Its IUPAC name is [(2R,3S,4R)-3-acetyloxy-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R)-3-acetyloxy-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 138516698 |
| Molecular Formula | C18H18F3N3O5 |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | [(2R,3S,4R)-3-acetyloxy-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OCC[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H18F3N3O5/c1-9(25)28-8-16-18(29-10(2)26)15(3-4-27-16)24-7-14(22-23-24)11-5-12(19)17(21)13(20)6-11/h5-7,15-16,18H,3-4,8H2,1-2H3/t15-,16-,18+/m1/s1 |
| InChIKey | HHIPUJKCKZLXBO-NUJGCVRESA-N |
| XLogP | 2.19 |
| TPSA | 92.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|