C16H21FN6O4 — CID 138516781
(2S,4aR,7R,8R,8aR)-6-azido-8-[1-fluoroethyl-(methyldiazenyl)amino]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol (PubChem CID 138516781) has the molecular formula C16H21FN6O4 and a molecular weight of 380.38 g/mol. Its IUPAC name is (2S,4aR,7R,8R,8aR)-6-azido-8-[1-fluoroethyl-(methyldiazenyl)amino]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol.
| Compound Name | (2S,4aR,7R,8R,8aR)-6-azido-8-[1-fluoroethyl-(methyldiazenyl)amino]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
|---|---|
| PubChem CID | 138516781 |
| Molecular Formula | C16H21FN6O4 |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | (2S,4aR,7R,8R,8aR)-6-azido-8-[1-fluoroethyl-(methyldiazenyl)amino]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
| SMILES | C/N=N/N(C(C)F)[C@H]1[C@H]2O[C@@H](c3ccccc3)OC[C@H]2OC(N=[N+]=[N-])[C@@H]1O |
| InChI | InChI=1S/C16H21FN6O4/c1-9(17)23(22-19-2)12-13(24)15(20-21-18)26-11-8-25-16(27-14(11)12)10-6-4-3-5-7-10/h3-7,9,11-16,24H,8H2,1-2H3/b22-19+/t9?,11-,12-,13-,14+,15?,16+/m1/s1 |
| InChIKey | MUYGHLQPTPINGU-XDBQMFRZSA-N |
| XLogP | 2.48 |
| TPSA | 124.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|