C18H17F3N6O5 — CID 138516920
[(2R,3R,4R)-3-acetyloxy-6-azido-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl acetate (PubChem CID 138516920) has the molecular formula C18H17F3N6O5 and a molecular weight of 454.37 g/mol. Its IUPAC name is [(2R,3R,4R)-3-acetyloxy-6-azido-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R)-3-acetyloxy-6-azido-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 138516920 |
| Molecular Formula | C18H17F3N6O5 |
| Molecular Weight | 454.37 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | [(2R,3R,4R)-3-acetyloxy-6-azido-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(N=[N+]=[N-])C[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C18H17F3N6O5/c1-8(28)30-7-15-18(31-9(2)29)14(5-16(32-15)24-25-22)27-6-13(23-26-27)10-3-11(19)17(21)12(20)4-10/h3-4,6,14-16,18H,5,7H2,1-2H3/t14-,15-,16?,18-/m1/s1 |
| InChIKey | XVTMODRQYQRLIN-VKAIUELNSA-N |
| XLogP | 2.82 |
| TPSA | 141.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|