C14H18FN3O3S — CID 138516921
(2R,3R,4R,6R)-4-(5-fluoro-4,5-dihydrotriazol-1-yl)-2-(hydroxymethyl)-6-phenylsulfanyloxan-3-ol (PubChem CID 138516921) has the molecular formula C14H18FN3O3S and a molecular weight of 327.38 g/mol. Its IUPAC name is (2R,3R,4R,6R)-4-(5-fluoro-4,5-dihydrotriazol-1-yl)-2-(hydroxymethyl)-6-phenylsulfanyloxan-3-ol.
| Compound Name | (2R,3R,4R,6R)-4-(5-fluoro-4,5-dihydrotriazol-1-yl)-2-(hydroxymethyl)-6-phenylsulfanyloxan-3-ol |
|---|---|
| PubChem CID | 138516921 |
| Molecular Formula | C14H18FN3O3S |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | (2R,3R,4R,6R)-4-(5-fluoro-4,5-dihydrotriazol-1-yl)-2-(hydroxymethyl)-6-phenylsulfanyloxan-3-ol |
| SMILES | OC[C@H]1O[C@H](Sc2ccccc2)C[C@@H](N2N=NCC2F)[C@H]1O |
| InChI | InChI=1S/C14H18FN3O3S/c15-12-7-16-17-18(12)10-6-13(21-11(8-19)14(10)20)22-9-4-2-1-3-5-9/h1-5,10-14,19-20H,6-8H2/t10-,11-,12?,13-,14-/m1/s1 |
| InChIKey | RCZWCEGOPNPISC-FUBAIUDDSA-N |
| XLogP | 1.59 |
| TPSA | 77.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|