C22H20F3N7O5 — CID 138516969
(2R,3R,4R,5R,6S)-2-(hydroxymethyl)-6-[4-(2-methoxy-4-pyridinyl)-1,2,4-triazol-3-yl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol (PubChem CID 138516969) has the molecular formula C22H20F3N7O5 and a molecular weight of 519.44 g/mol. Its IUPAC name is (2R,3R,4R,5R,6S)-2-(hydroxymethyl)-6-[4-(2-methoxy-4-pyridinyl)-1,2,4-triazol-3-yl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol.
| Compound Name | (2R,3R,4R,5R,6S)-2-(hydroxymethyl)-6-[4-(2-methoxy-4-pyridinyl)-1,2,4-triazol-3-yl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
|---|---|
| PubChem CID | 138516969 |
| Molecular Formula | C22H20F3N7O5 |
| Molecular Weight | 519.44 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | (2R,3R,4R,5R,6S)-2-(hydroxymethyl)-6-[4-(2-methoxy-4-pyridinyl)-1,2,4-triazol-3-yl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
| SMILES | COc1cc(-n2cnnc2[C@@H]2O[C@H](CO)[C@H](O)[C@H](n3cc(-c4cc(F)c(F)c(F)c4)nn3)[C@H]2O)ccn1 |
| InChI | InChI=1S/C22H20F3N7O5/c1-36-16-6-11(2-3-26-16)31-9-27-29-22(31)21-20(35)18(19(34)15(8-33)37-21)32-7-14(28-30-32)10-4-12(23)17(25)13(24)5-10/h2-7,9,15,18-21,33-35H,8H2,1H3/t15-,18+,19+,20-,21-/m1/s1 |
| InChIKey | BDGZDCIMKWMVRM-YNUHATHGSA-N |
| XLogP | 0.74 |
| TPSA | 153.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.44 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|