C13H19F3O2 — CID 138517351
(2E,4Z)-6-methyl-6-propan-2-yloxy-3-(1,2,2-trifluoroethenoxy)hepta-2,4-diene (PubChem CID 138517351) has the molecular formula C13H19F3O2 and a molecular weight of 264.29 g/mol. Its IUPAC name is (2E,4Z)-6-methyl-6-propan-2-yloxy-3-(1,2,2-trifluoroethenoxy)hepta-2,4-diene.
| Compound Name | (2E,4Z)-6-methyl-6-propan-2-yloxy-3-(1,2,2-trifluoroethenoxy)hepta-2,4-diene |
|---|---|
| PubChem CID | 138517351 |
| Molecular Formula | C13H19F3O2 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | (2E,4Z)-6-methyl-6-propan-2-yloxy-3-(1,2,2-trifluoroethenoxy)hepta-2,4-diene |
| SMILES | C/C=C(\C=C/C(C)(C)OC(C)C)OC(F)=C(F)F |
| InChI | InChI=1S/C13H19F3O2/c1-6-10(17-12(16)11(14)15)7-8-13(4,5)18-9(2)3/h6-9H,1-5H3/b8-7-,10-6+ |
| InChIKey | JCVWDMJFQQJKLK-SDHBEMGISA-N |
| XLogP | 4.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|