About [1-(2-ethylhexylsulfanyl)-1-oxooctadecan-9-yl] 4-oxopentanoate
[1-(2-ethylhexylsulfanyl)-1-oxooctadecan-9-yl] 4-oxopentanoate (PubChem CID 138517601) has the molecular formula C31H58O4S
and a molecular weight of 526.87 g/mol. Its IUPAC name is [1-(2-ethylhexylsulfanyl)-1-oxooctadecan-9-yl] 4-oxopentanoate.
Molecular Properties
| Compound Name | [1-(2-ethylhexylsulfanyl)-1-oxooctadecan-9-yl] 4-oxopentanoate |
| PubChem CID | 138517601 |
| Molecular Formula | C31H58O4S |
| Molecular Weight | 526.87 g/mol |
| Exact Mass | 526.41 |
| IUPAC Name | [1-(2-ethylhexylsulfanyl)-1-oxooctadecan-9-yl] 4-oxopentanoate |
| SMILES | CCCCCCCCCC(CCCCCCCC(=O)SCC(CC)CCCC)OC(=O)CCC(C)=O |
| InChI | InChI=1S/C31H58O4S/c1-5-8-10-11-12-14-17-21-29(35-30(33)25-24-27(4)32)22-18-15-13-16-19-23-31(34)36-26-28(7-3)20-9-6-2/h28-29H,5-26H2,1-4H3 |
| InChIKey | VRLFWHYHJQNVBN-UHFFFAOYSA-N |
| XLogP | 9.61 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 526.87 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze [1-(2-ethylhexylsulfanyl)-1-oxooctadecan-9-yl] 4-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2-ethylhexylsulfanyl)-1-oxooctadecan-9-yl] 4-oxopentanoate?
The IUPAC name of [1-(2-ethylhexylsulfanyl)-1-oxooctadecan-9-yl] 4-oxopentanoate (CID 138517601) is [1-(2-ethylhexylsulfanyl)-1-oxooctadecan-9-yl] 4-oxopentanoate.
What is the SMILES notation for [1-(2-ethylhexylsulfanyl)-1-oxooctadecan-9-yl] 4-oxopentanoate?
The canonical SMILES for [1-(2-ethylhexylsulfanyl)-1-oxooctadecan-9-yl] 4-oxopentanoate is CCCCCCCCCC(CCCCCCCC(=O)SCC(CC)CCCC)OC(=O)CCC(C)=O.
What is the InChIKey of [1-(2-ethylhexylsulfanyl)-1-oxooctadecan-9-yl] 4-oxopentanoate?
The InChIKey is VRLFWHYHJQNVBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H58O4S/c1-5-8-10-11-12-14-17-21-29(35-30(33)25-24-27(4)32)22-18-15-13-16-19-23-31(34)36-26-28(7-3)20-9-6-2/h28-29H,5-26H2,1-4H3.
What are the key properties of [1-(2-ethylhexylsulfanyl)-1-oxooctadecan-9-yl] 4-oxopentanoate?
[1-(2-ethylhexylsulfanyl)-1-oxooctadecan-9-yl] 4-oxopentanoate has a molecular weight of 526.87 g/mol, XLogP of 9.61, 26 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2-ethylhexylsulfanyl)-1-oxooctadecan-9-yl] 4-oxopentanoate is sourced from PubChem (CID 138517601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).