C20H25F3N4O — CID 138518453
1-ethyl-3-(7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl)-1-(2,2,2-trifluoroethyl)urea (PubChem CID 138518453) has the molecular formula C20H25F3N4O and a molecular weight of 394.44 g/mol. Its IUPAC name is 1-ethyl-3-(7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl)-1-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-ethyl-3-(7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl)-1-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 138518453 |
| Molecular Formula | C20H25F3N4O |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 1-ethyl-3-(7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl)-1-(2,2,2-trifluoroethyl)urea |
| SMILES | CCN(CC(F)(F)F)C(=O)NC1CC2c3cccc4[nH]cc(c34)CC2N(C)C1 |
| InChI | InChI=1S/C20H25F3N4O/c1-3-27(11-20(21,22)23)19(28)25-13-8-15-14-5-4-6-16-18(14)12(9-24-16)7-17(15)26(2)10-13/h4-6,9,13,15,17,24H,3,7-8,10-11H2,1-2H3,(H,25,28) |
| InChIKey | NXVNAQFLBVKSEJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |