About N-(3,7-dimethyloct-6-enyl)-4-methoxy-N-octylcyclohexa-1,5-dien-1-amine
N-(3,7-dimethyloct-6-enyl)-4-methoxy-N-octylcyclohexa-1,5-dien-1-amine (PubChem CID 138518681) has the molecular formula C25H45NO
and a molecular weight of 375.64 g/mol. Its IUPAC name is N-(3,7-dimethyloct-6-enyl)-4-methoxy-N-octylcyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | N-(3,7-dimethyloct-6-enyl)-4-methoxy-N-octylcyclohexa-1,5-dien-1-amine |
| PubChem CID | 138518681 |
| Molecular Formula | C25H45NO |
| Molecular Weight | 375.64 g/mol |
| Exact Mass | 375.35 |
| IUPAC Name | N-(3,7-dimethyloct-6-enyl)-4-methoxy-N-octylcyclohexa-1,5-dien-1-amine |
| SMILES | CCCCCCCCN(CCC(C)CCC=C(C)C)C1=CCC(OC)C=C1 |
| InChI | InChI=1S/C25H45NO/c1-6-7-8-9-10-11-20-26(24-15-17-25(27-5)18-16-24)21-19-23(4)14-12-13-22(2)3/h13,15-17,23,25H,6-12,14,18-21H2,1-5H3 |
| InChIKey | RGMADAMEBZAGGS-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.64 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(3,7-dimethyloct-6-enyl)-4-methoxy-N-octylcyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,7-dimethyloct-6-enyl)-4-methoxy-N-octylcyclohexa-1,5-dien-1-amine?
The IUPAC name of N-(3,7-dimethyloct-6-enyl)-4-methoxy-N-octylcyclohexa-1,5-dien-1-amine (CID 138518681) is N-(3,7-dimethyloct-6-enyl)-4-methoxy-N-octylcyclohexa-1,5-dien-1-amine.
What is the SMILES notation for N-(3,7-dimethyloct-6-enyl)-4-methoxy-N-octylcyclohexa-1,5-dien-1-amine?
The canonical SMILES for N-(3,7-dimethyloct-6-enyl)-4-methoxy-N-octylcyclohexa-1,5-dien-1-amine is CCCCCCCCN(CCC(C)CCC=C(C)C)C1=CCC(OC)C=C1.
What is the InChIKey of N-(3,7-dimethyloct-6-enyl)-4-methoxy-N-octylcyclohexa-1,5-dien-1-amine?
The InChIKey is RGMADAMEBZAGGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H45NO/c1-6-7-8-9-10-11-20-26(24-15-17-25(27-5)18-16-24)21-19-23(4)14-12-13-22(2)3/h13,15-17,23,25H,6-12,14,18-21H2,1-5H3.
What are the key properties of N-(3,7-dimethyloct-6-enyl)-4-methoxy-N-octylcyclohexa-1,5-dien-1-amine?
N-(3,7-dimethyloct-6-enyl)-4-methoxy-N-octylcyclohexa-1,5-dien-1-amine has a molecular weight of 375.64 g/mol, XLogP of 7.28, 15 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,7-dimethyloct-6-enyl)-4-methoxy-N-octylcyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 138518681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).