About (Z,2E)-1-N'-ethyl-2-ethylidenepent-3-ene-1,1-diamine
(Z,2E)-1-N'-ethyl-2-ethylidenepent-3-ene-1,1-diamine (PubChem CID 138518695) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is (Z,2E)-1-N'-ethyl-2-ethylidenepent-3-ene-1,1-diamine.
Molecular Properties
| Compound Name | (Z,2E)-1-N'-ethyl-2-ethylidenepent-3-ene-1,1-diamine |
| PubChem CID | 138518695 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | (Z,2E)-1-N'-ethyl-2-ethylidenepent-3-ene-1,1-diamine |
| SMILES | C/C=C\C(=C/C)C(N)NCC |
| InChI | InChI=1S/C9H18N2/c1-4-7-8(5-2)9(10)11-6-3/h4-5,7,9,11H,6,10H2,1-3H3/b7-4-,8-5+ |
| InChIKey | UTUVDQGEXXNLBH-DKBJKEKUSA-N |
| XLogP | 1.40 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z,2E)-1-N'-ethyl-2-ethylidenepent-3-ene-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z,2E)-1-N'-ethyl-2-ethylidenepent-3-ene-1,1-diamine?
The IUPAC name of (Z,2E)-1-N'-ethyl-2-ethylidenepent-3-ene-1,1-diamine (CID 138518695) is (Z,2E)-1-N'-ethyl-2-ethylidenepent-3-ene-1,1-diamine.
What is the SMILES notation for (Z,2E)-1-N'-ethyl-2-ethylidenepent-3-ene-1,1-diamine?
The canonical SMILES for (Z,2E)-1-N'-ethyl-2-ethylidenepent-3-ene-1,1-diamine is C/C=C\C(=C/C)C(N)NCC.
What is the InChIKey of (Z,2E)-1-N'-ethyl-2-ethylidenepent-3-ene-1,1-diamine?
The InChIKey is UTUVDQGEXXNLBH-DKBJKEKUSA-N. The full InChI is InChI=1S/C9H18N2/c1-4-7-8(5-2)9(10)11-6-3/h4-5,7,9,11H,6,10H2,1-3H3/b7-4-,8-5+.
What are the key properties of (Z,2E)-1-N'-ethyl-2-ethylidenepent-3-ene-1,1-diamine?
(Z,2E)-1-N'-ethyl-2-ethylidenepent-3-ene-1,1-diamine has a molecular weight of 154.26 g/mol, XLogP of 1.40, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,2E)-1-N'-ethyl-2-ethylidenepent-3-ene-1,1-diamine is sourced from PubChem (CID 138518695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).