C17H27NO2 — CID 138518898
N-ethyl-N-[(4-methoxycyclohexa-1,5-dien-1-yl)methyl]-2-[(1Z)-penta-1,4-dienoxy]ethanamine (PubChem CID 138518898) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is N-ethyl-N-[(4-methoxycyclohexa-1,5-dien-1-yl)methyl]-2-[(1Z)-penta-1,4-dienoxy]ethanamine.
| Compound Name | N-ethyl-N-[(4-methoxycyclohexa-1,5-dien-1-yl)methyl]-2-[(1Z)-penta-1,4-dienoxy]ethanamine |
|---|---|
| PubChem CID | 138518898 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | N-ethyl-N-[(4-methoxycyclohexa-1,5-dien-1-yl)methyl]-2-[(1Z)-penta-1,4-dienoxy]ethanamine |
| SMILES | C=CC/C=C\OCCN(CC)CC1=CCC(OC)C=C1 |
| InChI | InChI=1S/C17H27NO2/c1-4-6-7-13-20-14-12-18(5-2)15-16-8-10-17(19-3)11-9-16/h4,7-10,13,17H,1,5-6,11-12,14-15H2,2-3H3/b13-7- |
| InChIKey | TYDSNIZERNAPPY-QPEQYQDCSA-N |
| XLogP | 3.32 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|