C21H34INO2 — CID 138519088
(2E,4Z)-N-hexyl-6-iodo-6-methoxy-N-[(4-methoxycyclohexa-1,5-dien-1-yl)methyl]hexa-2,4-dien-3-amine (PubChem CID 138519088) has the molecular formula C21H34INO2 and a molecular weight of 459.41 g/mol. Its IUPAC name is (2E,4Z)-N-hexyl-6-iodo-6-methoxy-N-[(4-methoxycyclohexa-1,5-dien-1-yl)methyl]hexa-2,4-dien-3-amine.
| Compound Name | (2E,4Z)-N-hexyl-6-iodo-6-methoxy-N-[(4-methoxycyclohexa-1,5-dien-1-yl)methyl]hexa-2,4-dien-3-amine |
|---|---|
| PubChem CID | 138519088 |
| Molecular Formula | C21H34INO2 |
| Molecular Weight | 459.41 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | (2E,4Z)-N-hexyl-6-iodo-6-methoxy-N-[(4-methoxycyclohexa-1,5-dien-1-yl)methyl]hexa-2,4-dien-3-amine |
| SMILES | C/C=C(\C=C/C(I)OC)N(CCCCCC)CC1=CCC(OC)C=C1 |
| InChI | InChI=1S/C21H34INO2/c1-5-7-8-9-16-23(19(6-2)12-15-21(22)25-4)17-18-10-13-20(24-3)14-11-18/h6,10-13,15,20-21H,5,7-9,14,16-17H2,1-4H3/b15-12-,19-6+ |
| InChIKey | LXLPMIRYZZRCGF-ZWLWMWDCSA-N |
| XLogP | 5.64 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.41 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|