About N-butyl-4-methoxy-N-[[4-(trifluoromethyl)phenyl]methyl]cyclohexa-1,3-dien-1-amine
N-butyl-4-methoxy-N-[[4-(trifluoromethyl)phenyl]methyl]cyclohexa-1,3-dien-1-amine (PubChem CID 138519213) has the molecular formula C19H24F3NO
and a molecular weight of 339.40 g/mol. Its IUPAC name is N-butyl-4-methoxy-N-[[4-(trifluoromethyl)phenyl]methyl]cyclohexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | N-butyl-4-methoxy-N-[[4-(trifluoromethyl)phenyl]methyl]cyclohexa-1,3-dien-1-amine |
| PubChem CID | 138519213 |
| Molecular Formula | C19H24F3NO |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | N-butyl-4-methoxy-N-[[4-(trifluoromethyl)phenyl]methyl]cyclohexa-1,3-dien-1-amine |
| SMILES | CCCCN(Cc1ccc(C(F)(F)F)cc1)C1=CC=C(OC)CC1 |
| InChI | InChI=1S/C19H24F3NO/c1-3-4-13-23(17-9-11-18(24-2)12-10-17)14-15-5-7-16(8-6-15)19(20,21)22/h5-9,11H,3-4,10,12-14H2,1-2H3 |
| InChIKey | SDGNHKSYRPSVDL-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-butyl-4-methoxy-N-[[4-(trifluoromethyl)phenyl]methyl]cyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-4-methoxy-N-[[4-(trifluoromethyl)phenyl]methyl]cyclohexa-1,3-dien-1-amine?
The IUPAC name of N-butyl-4-methoxy-N-[[4-(trifluoromethyl)phenyl]methyl]cyclohexa-1,3-dien-1-amine (CID 138519213) is N-butyl-4-methoxy-N-[[4-(trifluoromethyl)phenyl]methyl]cyclohexa-1,3-dien-1-amine.
What is the SMILES notation for N-butyl-4-methoxy-N-[[4-(trifluoromethyl)phenyl]methyl]cyclohexa-1,3-dien-1-amine?
The canonical SMILES for N-butyl-4-methoxy-N-[[4-(trifluoromethyl)phenyl]methyl]cyclohexa-1,3-dien-1-amine is CCCCN(Cc1ccc(C(F)(F)F)cc1)C1=CC=C(OC)CC1.
What is the InChIKey of N-butyl-4-methoxy-N-[[4-(trifluoromethyl)phenyl]methyl]cyclohexa-1,3-dien-1-amine?
The InChIKey is SDGNHKSYRPSVDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24F3NO/c1-3-4-13-23(17-9-11-18(24-2)12-10-17)14-15-5-7-16(8-6-15)19(20,21)22/h5-9,11H,3-4,10,12-14H2,1-2H3.
What are the key properties of N-butyl-4-methoxy-N-[[4-(trifluoromethyl)phenyl]methyl]cyclohexa-1,3-dien-1-amine?
N-butyl-4-methoxy-N-[[4-(trifluoromethyl)phenyl]methyl]cyclohexa-1,3-dien-1-amine has a molecular weight of 339.40 g/mol, XLogP of 5.52, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-4-methoxy-N-[[4-(trifluoromethyl)phenyl]methyl]cyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 138519213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).