C26H45NO — CID 138519271
N-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methoxy-N-nonan-2-ylcyclohexa-1,5-dien-1-amine (PubChem CID 138519271) has the molecular formula C26H45NO and a molecular weight of 387.65 g/mol. Its IUPAC name is N-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methoxy-N-nonan-2-ylcyclohexa-1,5-dien-1-amine.
| Compound Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methoxy-N-nonan-2-ylcyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 138519271 |
| Molecular Formula | C26H45NO |
| Molecular Weight | 387.65 g/mol |
| Exact Mass | 387.35 |
| IUPAC Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methoxy-N-nonan-2-ylcyclohexa-1,5-dien-1-amine |
| SMILES | CCCCCCCC(C)N(C/C=C(\C)CCC=C(C)C)C1=CCC(OC)C=C1 |
| InChI | InChI=1S/C26H45NO/c1-7-8-9-10-11-15-24(5)27(25-16-18-26(28-6)19-17-25)21-20-23(4)14-12-13-22(2)3/h13,16-18,20,24,26H,7-12,14-15,19,21H2,1-6H3/b23-20+ |
| InChIKey | VZUDFSGFCHUSID-BSYVCWPDSA-N |
| XLogP | 7.59 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.65 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|