C20H35NO2 — CID 138519690
2-[3,7-dimethyloct-6-enyl-(4-methoxy-3-methylcyclohexa-1,5-dien-1-yl)amino]ethanol (PubChem CID 138519690) has the molecular formula C20H35NO2 and a molecular weight of 321.51 g/mol. Its IUPAC name is 2-[3,7-dimethyloct-6-enyl-(4-methoxy-3-methylcyclohexa-1,5-dien-1-yl)amino]ethanol.
| Compound Name | 2-[3,7-dimethyloct-6-enyl-(4-methoxy-3-methylcyclohexa-1,5-dien-1-yl)amino]ethanol |
|---|---|
| PubChem CID | 138519690 |
| Molecular Formula | C20H35NO2 |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.27 |
| IUPAC Name | 2-[3,7-dimethyloct-6-enyl-(4-methoxy-3-methylcyclohexa-1,5-dien-1-yl)amino]ethanol |
| SMILES | COC1C=CC(N(CCO)CCC(C)CCC=C(C)C)=CC1C |
| InChI | InChI=1S/C20H35NO2/c1-16(2)7-6-8-17(3)11-12-21(13-14-22)19-9-10-20(23-5)18(4)15-19/h7,9-10,15,17-18,20,22H,6,8,11-14H2,1-5H3 |
| InChIKey | PBEFZBPHLNHMPV-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|