About (1R)-N-hexa-1,3-dien-3-yl-3-(2-piperidin-1-ylethyl)-5-(trifluoromethyl)cyclohexan-1-amine
(1R)-N-hexa-1,3-dien-3-yl-3-(2-piperidin-1-ylethyl)-5-(trifluoromethyl)cyclohexan-1-amine (PubChem CID 138519745) has the molecular formula C20H33F3N2
and a molecular weight of 358.49 g/mol. Its IUPAC name is (1R)-N-hexa-1,3-dien-3-yl-3-(2-piperidin-1-ylethyl)-5-(trifluoromethyl)cyclohexan-1-amine.
Molecular Properties
| Compound Name | (1R)-N-hexa-1,3-dien-3-yl-3-(2-piperidin-1-ylethyl)-5-(trifluoromethyl)cyclohexan-1-amine |
| PubChem CID | 138519745 |
| Molecular Formula | C20H33F3N2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | (1R)-N-hexa-1,3-dien-3-yl-3-(2-piperidin-1-ylethyl)-5-(trifluoromethyl)cyclohexan-1-amine |
| SMILES | C=CC(=CCC)N[C@@H]1CC(CCN2CCCCC2)CC(C(F)(F)F)C1 |
| InChI | InChI=1S/C20H33F3N2/c1-3-8-18(4-2)24-19-14-16(13-17(15-19)20(21,22)23)9-12-25-10-6-5-7-11-25/h4,8,16-17,19,24H,2-3,5-7,9-15H2,1H3/t16?,17?,19-/m1/s1 |
| InChIKey | GHHNJQZKJPAERI-FAFZWHIHSA-N |
| XLogP | 5.28 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1R)-N-hexa-1,3-dien-3-yl-3-(2-piperidin-1-ylethyl)-5-(trifluoromethyl)cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-N-hexa-1,3-dien-3-yl-3-(2-piperidin-1-ylethyl)-5-(trifluoromethyl)cyclohexan-1-amine?
The IUPAC name of (1R)-N-hexa-1,3-dien-3-yl-3-(2-piperidin-1-ylethyl)-5-(trifluoromethyl)cyclohexan-1-amine (CID 138519745) is (1R)-N-hexa-1,3-dien-3-yl-3-(2-piperidin-1-ylethyl)-5-(trifluoromethyl)cyclohexan-1-amine.
What is the SMILES notation for (1R)-N-hexa-1,3-dien-3-yl-3-(2-piperidin-1-ylethyl)-5-(trifluoromethyl)cyclohexan-1-amine?
The canonical SMILES for (1R)-N-hexa-1,3-dien-3-yl-3-(2-piperidin-1-ylethyl)-5-(trifluoromethyl)cyclohexan-1-amine is C=CC(=CCC)N[C@@H]1CC(CCN2CCCCC2)CC(C(F)(F)F)C1.
What is the InChIKey of (1R)-N-hexa-1,3-dien-3-yl-3-(2-piperidin-1-ylethyl)-5-(trifluoromethyl)cyclohexan-1-amine?
The InChIKey is GHHNJQZKJPAERI-FAFZWHIHSA-N. The full InChI is InChI=1S/C20H33F3N2/c1-3-8-18(4-2)24-19-14-16(13-17(15-19)20(21,22)23)9-12-25-10-6-5-7-11-25/h4,8,16-17,19,24H,2-3,5-7,9-15H2,1H3/t16?,17?,19-/m1/s1.
What are the key properties of (1R)-N-hexa-1,3-dien-3-yl-3-(2-piperidin-1-ylethyl)-5-(trifluoromethyl)cyclohexan-1-amine?
(1R)-N-hexa-1,3-dien-3-yl-3-(2-piperidin-1-ylethyl)-5-(trifluoromethyl)cyclohexan-1-amine has a molecular weight of 358.49 g/mol, XLogP of 5.28, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-N-hexa-1,3-dien-3-yl-3-(2-piperidin-1-ylethyl)-5-(trifluoromethyl)cyclohexan-1-amine is sourced from PubChem (CID 138519745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).