About (1-oxo-2,6,7-trioxa-1λ5-phosphabicyclo[2.2.2]octan-4-yl)methyl 3-sulfanylpropanoate
(1-oxo-2,6,7-trioxa-1λ5-phosphabicyclo[2.2.2]octan-4-yl)methyl 3-sulfanylpropanoate (PubChem CID 138519922) has the molecular formula C8H13O6PS
and a molecular weight of 268.23 g/mol. Its IUPAC name is (1-oxo-2,6,7-trioxa-1λ5-phosphabicyclo[2.2.2]octan-4-yl)methyl 3-sulfanylpropanoate.
Molecular Properties
| Compound Name | (1-oxo-2,6,7-trioxa-1λ5-phosphabicyclo[2.2.2]octan-4-yl)methyl 3-sulfanylpropanoate |
| PubChem CID | 138519922 |
| Molecular Formula | C8H13O6PS |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | (1-oxo-2,6,7-trioxa-1λ5-phosphabicyclo[2.2.2]octan-4-yl)methyl 3-sulfanylpropanoate |
| SMILES | O=C(CCS)OCC12COP(=O)(OC1)OC2 |
| InChI | InChI=1S/C8H13O6PS/c9-7(1-2-16)11-3-8-4-12-15(10,13-5-8)14-6-8/h16H,1-6H2 |
| InChIKey | NKBKIWSTZBYCNH-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 71.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (1-oxo-2,6,7-trioxa-1λ5-phosphabicyclo[2.2.2]octan-4-yl)methyl 3-sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-oxo-2,6,7-trioxa-1λ5-phosphabicyclo[2.2.2]octan-4-yl)methyl 3-sulfanylpropanoate?
The IUPAC name of (1-oxo-2,6,7-trioxa-1λ5-phosphabicyclo[2.2.2]octan-4-yl)methyl 3-sulfanylpropanoate (CID 138519922) is (1-oxo-2,6,7-trioxa-1λ5-phosphabicyclo[2.2.2]octan-4-yl)methyl 3-sulfanylpropanoate.
What is the SMILES notation for (1-oxo-2,6,7-trioxa-1λ5-phosphabicyclo[2.2.2]octan-4-yl)methyl 3-sulfanylpropanoate?
The canonical SMILES for (1-oxo-2,6,7-trioxa-1λ5-phosphabicyclo[2.2.2]octan-4-yl)methyl 3-sulfanylpropanoate is O=C(CCS)OCC12COP(=O)(OC1)OC2.
What is the InChIKey of (1-oxo-2,6,7-trioxa-1λ5-phosphabicyclo[2.2.2]octan-4-yl)methyl 3-sulfanylpropanoate?
The InChIKey is NKBKIWSTZBYCNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13O6PS/c9-7(1-2-16)11-3-8-4-12-15(10,13-5-8)14-6-8/h16H,1-6H2.
What are the key properties of (1-oxo-2,6,7-trioxa-1λ5-phosphabicyclo[2.2.2]octan-4-yl)methyl 3-sulfanylpropanoate?
(1-oxo-2,6,7-trioxa-1λ5-phosphabicyclo[2.2.2]octan-4-yl)methyl 3-sulfanylpropanoate has a molecular weight of 268.23 g/mol, XLogP of 1.02, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (1-oxo-2,6,7-trioxa-1λ5-phosphabicyclo[2.2.2]octan-4-yl)methyl 3-sulfanylpropanoate is sourced from PubChem (CID 138519922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).