C14H26O3S — CID 138519929
4-ethyl-1,6,7,9,9-pentamethyl-2-oxa-3λ6-thiabicyclo[4.2.1]nonane 3,3-dioxide (PubChem CID 138519929) has the molecular formula C14H26O3S and a molecular weight of 274.43 g/mol. Its IUPAC name is 4-ethyl-1,6,7,9,9-pentamethyl-2-oxa-3λ6-thiabicyclo[4.2.1]nonane 3,3-dioxide.
| Compound Name | 4-ethyl-1,6,7,9,9-pentamethyl-2-oxa-3λ6-thiabicyclo[4.2.1]nonane 3,3-dioxide |
|---|---|
| PubChem CID | 138519929 |
| Molecular Formula | C14H26O3S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 4-ethyl-1,6,7,9,9-pentamethyl-2-oxa-3λ6-thiabicyclo[4.2.1]nonane 3,3-dioxide |
| SMILES | CCC1CC2(C)C(C)CC(C)(OS1(=O)=O)C2(C)C |
| InChI | InChI=1S/C14H26O3S/c1-7-11-9-13(5)10(2)8-14(6,12(13,3)4)17-18(11,15)16/h10-11H,7-9H2,1-6H3 |
| InChIKey | NVTSMHDWELHZAF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|