C17H24O2 — CID 138520001
9'-ethylspiro[oxolane-4,4'-tetracyclo[6.2.1.13,6.02,7]dodecane]-2-one (PubChem CID 138520001) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is 9'-ethylspiro[oxolane-4,4'-tetracyclo[6.2.1.13,6.02,7]dodecane]-2-one.
| Compound Name | 9'-ethylspiro[oxolane-4,4'-tetracyclo[6.2.1.13,6.02,7]dodecane]-2-one |
|---|---|
| PubChem CID | 138520001 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 9'-ethylspiro[oxolane-4,4'-tetracyclo[6.2.1.13,6.02,7]dodecane]-2-one |
| SMILES | CCC1CC2CC1C1C3CC(C21)C1(COC(=O)C1)C3 |
| InChI | InChI=1S/C17H24O2/c1-2-9-3-10-4-12(9)15-11-5-13(16(10)15)17(6-11)7-14(18)19-8-17/h9-13,15-16H,2-8H2,1H3 |
| InChIKey | BCJNWEATZAUXOK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|