C11H10O7S2 — CID 138520071
(5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nona-1(9),2,6-trien-2-yl)oxymethyl 2-methyl-3-sulfanylpropanoate (PubChem CID 138520071) has the molecular formula C11H10O7S2 and a molecular weight of 318.33 g/mol. Its IUPAC name is (5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nona-1(9),2,6-trien-2-yl)oxymethyl 2-methyl-3-sulfanylpropanoate.
| Compound Name | (5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nona-1(9),2,6-trien-2-yl)oxymethyl 2-methyl-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 138520071 |
| Molecular Formula | C11H10O7S2 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | (5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nona-1(9),2,6-trien-2-yl)oxymethyl 2-methyl-3-sulfanylpropanoate |
| SMILES | CC(CS)C(=O)OCOc1c2c3oc1cc3S(=O)(=O)O2 |
| InChI | InChI=1S/C11H10O7S2/c1-5(3-19)11(12)16-4-15-8-6-2-7-9(17-6)10(8)18-20(7,13)14/h2,5,19H,3-4H2,1H3 |
| InChIKey | HQEVIHHSKNTOFQ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|