C15H17N7O8 — CID 138520972
(3R,4S,5S,6R)-6-[[4-[[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]methyl]triazol-1-yl]methyl]oxane-2,3,4,5-tetrol (PubChem CID 138520972) has the molecular formula C15H17N7O8 and a molecular weight of 423.34 g/mol. Its IUPAC name is (3R,4S,5S,6R)-6-[[4-[[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]methyl]triazol-1-yl]methyl]oxane-2,3,4,5-tetrol.
| Compound Name | (3R,4S,5S,6R)-6-[[4-[[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]methyl]triazol-1-yl]methyl]oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 138520972 |
| Molecular Formula | C15H17N7O8 |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | (3R,4S,5S,6R)-6-[[4-[[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]methyl]triazol-1-yl]methyl]oxane-2,3,4,5-tetrol |
| SMILES | O=[N+]([O-])c1ccc(NCc2cn(C[C@H]3OC(O)[C@H](O)[C@@H](O)[C@@H]3O)nn2)c2nonc12 |
| InChI | InChI=1S/C15H17N7O8/c23-12-9(29-15(26)14(25)13(12)24)5-21-4-6(17-20-21)3-16-7-1-2-8(22(27)28)11-10(7)18-30-19-11/h1-2,4,9,12-16,23-26H,3,5H2/t9-,12-,13+,14-,15?/m1/s1 |
| InChIKey | GMEMXCJEEDLMGF-MUAKSPJCSA-N |
| XLogP | -1.87 |
| TPSA | 214.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|