C12H9ClFN3O3 — CID 138521114
[(1S,4R)-4-(4-chloro-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)cyclopent-2-en-1-yl] hydrogen carbonate (PubChem CID 138521114) has the molecular formula C12H9ClFN3O3 and a molecular weight of 297.67 g/mol. Its IUPAC name is [(1S,4R)-4-(4-chloro-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)cyclopent-2-en-1-yl] hydrogen carbonate.
| Compound Name | [(1S,4R)-4-(4-chloro-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)cyclopent-2-en-1-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 138521114 |
| Molecular Formula | C12H9ClFN3O3 |
| Molecular Weight | 297.67 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | [(1S,4R)-4-(4-chloro-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)cyclopent-2-en-1-yl] hydrogen carbonate |
| SMILES | O=C(O)O[C@@H]1C=C[C@H](n2cc(F)c3c(Cl)ncnc32)C1 |
| InChI | InChI=1S/C12H9ClFN3O3/c13-10-9-8(14)4-17(11(9)16-5-15-10)6-1-2-7(3-6)20-12(18)19/h1-2,4-7H,3H2,(H,18,19)/t6-,7+/m0/s1 |
| InChIKey | OKTBUICPIIERQO-NKWVEPMBSA-N |
| XLogP | 2.79 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.67 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|