About 1-(1,1-diaminobutoxy)butane-1,1-diamine;tetramethylazanium
1-(1,1-diaminobutoxy)butane-1,1-diamine;tetramethylazanium (PubChem CID 138521159) has the molecular formula C12H34N5O+
and a molecular weight of 264.44 g/mol. Its IUPAC name is 1-(1,1-diaminobutoxy)butane-1,1-diamine;tetramethylazanium.
Molecular Properties
| Compound Name | 1-(1,1-diaminobutoxy)butane-1,1-diamine;tetramethylazanium |
| PubChem CID | 138521159 |
| Molecular Formula | C12H34N5O+ |
| Molecular Weight | 264.44 g/mol |
| Exact Mass | 264.28 |
| IUPAC Name | 1-(1,1-diaminobutoxy)butane-1,1-diamine;tetramethylazanium |
| SMILES | CCCC(N)(N)OC(N)(N)CCC.C[N+](C)(C)C |
| InChI | InChI=1S/C8H22N4O.C4H12N/c1-3-5-7(9,10)13-8(11,12)6-4-2;1-5(2,3)4/h3-6,9-12H2,1-2H3;1-4H3/q;+1 |
| InChIKey | ZYXZEXAFETXTEJ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 113.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.44 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,1-diaminobutoxy)butane-1,1-diamine;tetramethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,1-diaminobutoxy)butane-1,1-diamine;tetramethylazanium?
The IUPAC name of 1-(1,1-diaminobutoxy)butane-1,1-diamine;tetramethylazanium (CID 138521159) is 1-(1,1-diaminobutoxy)butane-1,1-diamine;tetramethylazanium.
What is the SMILES notation for 1-(1,1-diaminobutoxy)butane-1,1-diamine;tetramethylazanium?
The canonical SMILES for 1-(1,1-diaminobutoxy)butane-1,1-diamine;tetramethylazanium is CCCC(N)(N)OC(N)(N)CCC.C[N+](C)(C)C.
What is the InChIKey of 1-(1,1-diaminobutoxy)butane-1,1-diamine;tetramethylazanium?
The InChIKey is ZYXZEXAFETXTEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H22N4O.C4H12N/c1-3-5-7(9,10)13-8(11,12)6-4-2;1-5(2,3)4/h3-6,9-12H2,1-2H3;1-4H3/q;+1.
What are the key properties of 1-(1,1-diaminobutoxy)butane-1,1-diamine;tetramethylazanium?
1-(1,1-diaminobutoxy)butane-1,1-diamine;tetramethylazanium has a molecular weight of 264.44 g/mol, XLogP of 0.07, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,1-diaminobutoxy)butane-1,1-diamine;tetramethylazanium is sourced from PubChem (CID 138521159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).