C25H25Cl3N6OS — CID 138521458
7-[3-chloro-4-[4-(dimethylamino)piperidin-1-yl]anilino]-3-(2,6-dichlorophenyl)-2H-pyrimido[5,4-e][1,3]thiazin-4-one (PubChem CID 138521458) has the molecular formula C25H25Cl3N6OS and a molecular weight of 563.94 g/mol. Its IUPAC name is 7-[3-chloro-4-[4-(dimethylamino)piperidin-1-yl]anilino]-3-(2,6-dichlorophenyl)-2H-pyrimido[5,4-e][1,3]thiazin-4-one.
| Compound Name | 7-[3-chloro-4-[4-(dimethylamino)piperidin-1-yl]anilino]-3-(2,6-dichlorophenyl)-2H-pyrimido[5,4-e][1,3]thiazin-4-one |
|---|---|
| PubChem CID | 138521458 |
| Molecular Formula | C25H25Cl3N6OS |
| Molecular Weight | 563.94 g/mol |
| Exact Mass | 562.09 |
| IUPAC Name | 7-[3-chloro-4-[4-(dimethylamino)piperidin-1-yl]anilino]-3-(2,6-dichlorophenyl)-2H-pyrimido[5,4-e][1,3]thiazin-4-one |
| SMILES | CN(C)C1CCN(c2ccc(Nc3ncc4c(n3)SCN(c3c(Cl)cccc3Cl)C4=O)cc2Cl)CC1 |
| InChI | InChI=1S/C25H25Cl3N6OS/c1-32(2)16-8-10-33(11-9-16)21-7-6-15(12-20(21)28)30-25-29-13-17-23(31-25)36-14-34(24(17)35)22-18(26)4-3-5-19(22)27/h3-7,12-13,16H,8-11,14H2,1-2H3,(H,29,30,31) |
| InChIKey | AWXGWWIDLWSKJL-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.94 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|