C11H15NO4S — CID 138522101
1-[4-(2-oxopropyl)phenyl]ethylsulfamic acid (PubChem CID 138522101) has the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. Its IUPAC name is 1-[4-(2-oxopropyl)phenyl]ethylsulfamic acid.
| Compound Name | 1-[4-(2-oxopropyl)phenyl]ethylsulfamic acid |
|---|---|
| PubChem CID | 138522101 |
| Molecular Formula | C11H15NO4S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 1-[4-(2-oxopropyl)phenyl]ethylsulfamic acid |
| SMILES | CC(=O)Cc1ccc(C(C)NS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C11H15NO4S/c1-8(13)7-10-3-5-11(6-4-10)9(2)12-17(14,15)16/h3-6,9,12H,7H2,1-2H3,(H,14,15,16) |
| InChIKey | SWHPQKHBRXOGOT-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|