C18H22F3NO3S — CID 138522112
[(1S,9S,10S)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] trifluoromethanesulfonate (PubChem CID 138522112) has the molecular formula C18H22F3NO3S and a molecular weight of 389.44 g/mol. Its IUPAC name is [(1S,9S,10S)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] trifluoromethanesulfonate.
| Compound Name | [(1S,9S,10S)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 138522112 |
| Molecular Formula | C18H22F3NO3S |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | [(1S,9S,10S)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] trifluoromethanesulfonate |
| SMILES | CN1CC[C@@]23CCCC[C@@H]2[C@@H]1Cc1ccc(OS(=O)(=O)C(F)(F)F)cc13 |
| InChI | InChI=1S/C18H22F3NO3S/c1-22-9-8-17-7-3-2-4-14(17)16(22)10-12-5-6-13(11-15(12)17)25-26(23,24)18(19,20)21/h5-6,11,14,16H,2-4,7-10H2,1H3/t14-,16+,17+/m1/s1 |
| InChIKey | FWQMRSWFMHVDGL-PVAVHDDUSA-N |
| XLogP | 3.60 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|