About 5-bromo-3-N-[(3,5-difluorophenyl)methyl]pyridine-2,3-diamine
5-bromo-3-N-[(3,5-difluorophenyl)methyl]pyridine-2,3-diamine (PubChem CID 138522249) has the molecular formula C12H10BrF2N3
and a molecular weight of 314.13 g/mol. Its IUPAC name is 5-bromo-3-N-[(3,5-difluorophenyl)methyl]pyridine-2,3-diamine.
Molecular Properties
| Compound Name | 5-bromo-3-N-[(3,5-difluorophenyl)methyl]pyridine-2,3-diamine |
| PubChem CID | 138522249 |
| Molecular Formula | C12H10BrF2N3 |
| Molecular Weight | 314.13 g/mol |
| Exact Mass | 313.00 |
| IUPAC Name | 5-bromo-3-N-[(3,5-difluorophenyl)methyl]pyridine-2,3-diamine |
| SMILES | Nc1ncc(Br)cc1NCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H10BrF2N3/c13-8-3-11(12(16)18-6-8)17-5-7-1-9(14)4-10(15)2-7/h1-4,6,17H,5H2,(H2,16,18) |
| InChIKey | YJAVLOSRARQMSD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.13 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-3-N-[(3,5-difluorophenyl)methyl]pyridine-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-N-[(3,5-difluorophenyl)methyl]pyridine-2,3-diamine?
The IUPAC name of 5-bromo-3-N-[(3,5-difluorophenyl)methyl]pyridine-2,3-diamine (CID 138522249) is 5-bromo-3-N-[(3,5-difluorophenyl)methyl]pyridine-2,3-diamine.
What is the SMILES notation for 5-bromo-3-N-[(3,5-difluorophenyl)methyl]pyridine-2,3-diamine?
The canonical SMILES for 5-bromo-3-N-[(3,5-difluorophenyl)methyl]pyridine-2,3-diamine is Nc1ncc(Br)cc1NCc1cc(F)cc(F)c1.
What is the InChIKey of 5-bromo-3-N-[(3,5-difluorophenyl)methyl]pyridine-2,3-diamine?
The InChIKey is YJAVLOSRARQMSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10BrF2N3/c13-8-3-11(12(16)18-6-8)17-5-7-1-9(14)4-10(15)2-7/h1-4,6,17H,5H2,(H2,16,18).
What are the key properties of 5-bromo-3-N-[(3,5-difluorophenyl)methyl]pyridine-2,3-diamine?
5-bromo-3-N-[(3,5-difluorophenyl)methyl]pyridine-2,3-diamine has a molecular weight of 314.13 g/mol, XLogP of 3.32, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-N-[(3,5-difluorophenyl)methyl]pyridine-2,3-diamine is sourced from PubChem (CID 138522249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).